C30H37N3O4 — CID 15595285
2-[4-[(5-hexoxy-6-methoxy-4-methylquinolin-8-yl)amino]pentyl]isoindole-1,3-dione (PubChem CID 15595285) has the molecular formula C30H37N3O4 and a molecular weight of 503.64 g/mol. Its IUPAC name is 2-[4-[(5-hexoxy-6-methoxy-4-methylquinolin-8-yl)amino]pentyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[(5-hexoxy-6-methoxy-4-methylquinolin-8-yl)amino]pentyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 15595285 |
| Molecular Formula | C30H37N3O4 |
| Molecular Weight | 503.64 g/mol |
| Exact Mass | 503.28 |
| IUPAC Name | 2-[4-[(5-hexoxy-6-methoxy-4-methylquinolin-8-yl)amino]pentyl]isoindole-1,3-dione |
| SMILES | CCCCCCOc1c(OC)cc(NC(C)CCCN2C(=O)c3ccccc3C2=O)c2nccc(C)c12 |
| InChI | InChI=1S/C30H37N3O4/c1-5-6-7-10-18-37-28-25(36-4)19-24(27-26(28)20(2)15-16-31-27)32-21(3)12-11-17-33-29(34)22-13-8-9-14-23(22)30(33)35/h8-9,13-16,19,21,32H,5-7,10-12,17-18H2,1-4H3 |
| InChIKey | BXSFMLKKZKCHOU-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.64 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|