C28H24N2O3 — CID 132575276
16-hexyl-7-methoxy-5,16-diazahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(20),2,4,6,8,10(23),11(21),12,14(22),18-decaene-15,17-dione (PubChem CID 132575276) has the molecular formula C28H24N2O3 and a molecular weight of 436.51 g/mol. Its IUPAC name is 16-hexyl-7-methoxy-5,16-diazahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(20),2,4,6,8,10(23),11(21),12,14(22),18-decaene-15,17-dione.
| Compound Name | 16-hexyl-7-methoxy-5,16-diazahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(20),2,4,6,8,10(23),11(21),12,14(22),18-decaene-15,17-dione |
|---|---|
| PubChem CID | 132575276 |
| Molecular Formula | C28H24N2O3 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | 16-hexyl-7-methoxy-5,16-diazahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(20),2,4,6,8,10(23),11(21),12,14(22),18-decaene-15,17-dione |
| SMILES | CCCCCCN1C(=O)c2ccc3c4ccnc5c(OC)ccc(c6ccc(c2c36)C1=O)c54 |
| InChI | InChI=1S/C28H24N2O3/c1-3-4-5-6-15-30-27(31)20-9-7-16-18-11-12-22(33-2)26-25(18)19(13-14-29-26)17-8-10-21(28(30)32)24(20)23(16)17/h7-14H,3-6,15H2,1-2H3 |
| InChIKey | RIDZTCBOLWCIQV-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|