C14H12N2O4 — CID 132534945
7-(2-hydroxyethyl)-12-methoxy-2,7-diazatricyclo[7.3.1.05,13]trideca-1(12),2,4,9(13),10-pentaene-6,8-dione (PubChem CID 132534945) has the molecular formula C14H12N2O4 and a molecular weight of 272.26 g/mol. Its IUPAC name is 7-(2-hydroxyethyl)-12-methoxy-2,7-diazatricyclo[7.3.1.05,13]trideca-1(12),2,4,9(13),10-pentaene-6,8-dione.
| Compound Name | 7-(2-hydroxyethyl)-12-methoxy-2,7-diazatricyclo[7.3.1.05,13]trideca-1(12),2,4,9(13),10-pentaene-6,8-dione |
|---|---|
| PubChem CID | 132534945 |
| Molecular Formula | C14H12N2O4 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 7-(2-hydroxyethyl)-12-methoxy-2,7-diazatricyclo[7.3.1.05,13]trideca-1(12),2,4,9(13),10-pentaene-6,8-dione |
| SMILES | COc1ccc2c3c(ccnc13)C(=O)N(CCO)C2=O |
| InChI | InChI=1S/C14H12N2O4/c1-20-10-3-2-8-11-9(4-5-15-12(10)11)14(19)16(6-7-17)13(8)18/h2-5,17H,6-7H2,1H3 |
| InChIKey | RHQIVYMGAAUOTM-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|