C10H7Cl2NO — CID 43531957
4,5-dichloro-8-methoxyquinoline (PubChem CID 43531957) has the molecular formula C10H7Cl2NO and a molecular weight of 228.08 g/mol. Its IUPAC name is 4,5-dichloro-8-methoxyquinoline.
| Compound Name | 4,5-dichloro-8-methoxyquinoline |
|---|---|
| PubChem CID | 43531957 |
| Molecular Formula | C10H7Cl2NO |
| Molecular Weight | 228.08 g/mol |
| Exact Mass | 226.99 |
| IUPAC Name | 4,5-dichloro-8-methoxyquinoline |
| SMILES | COc1ccc(Cl)c2c(Cl)ccnc12 |
| InChI | InChI=1S/C10H7Cl2NO/c1-14-8-3-2-6(11)9-7(12)4-5-13-10(8)9/h2-5H,1H3 |
| InChIKey | NEFIDYAMXSTZTN-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.08 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |