C14H10Cl2N2O2 — CID 12065047
4,7-dichloro-5,6-dimethoxy-1,10-phenanthroline (PubChem CID 12065047) has the molecular formula C14H10Cl2N2O2 and a molecular weight of 309.15 g/mol. Its IUPAC name is 4,7-dichloro-5,6-dimethoxy-1,10-phenanthroline.
| Compound Name | 4,7-dichloro-5,6-dimethoxy-1,10-phenanthroline |
|---|---|
| PubChem CID | 12065047 |
| Molecular Formula | C14H10Cl2N2O2 |
| Molecular Weight | 309.15 g/mol |
| Exact Mass | 308.01 |
| IUPAC Name | 4,7-dichloro-5,6-dimethoxy-1,10-phenanthroline |
| SMILES | COc1c(OC)c2c(Cl)ccnc2c2nccc(Cl)c12 |
| InChI | InChI=1S/C14H10Cl2N2O2/c1-19-13-9-7(15)3-5-17-11(9)12-10(14(13)20-2)8(16)4-6-18-12/h3-6H,1-2H3 |
| InChIKey | PKHHONSJYLZSQK-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.15 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|