C16H8Cl4N2Pd — CID 10162595
4,9-dichloroquinolino[7,8-h]quinoline;palladium(2+);dichloride (PubChem CID 10162595) has the molecular formula C16H8Cl4N2Pd and a molecular weight of 476.49 g/mol. Its IUPAC name is 4,9-dichloroquinolino[7,8-h]quinoline;palladium(2+);dichloride.
| Compound Name | 4,9-dichloroquinolino[7,8-h]quinoline;palladium(2+);dichloride |
|---|---|
| PubChem CID | 10162595 |
| Molecular Formula | C16H8Cl4N2Pd |
| Molecular Weight | 476.49 g/mol |
| Exact Mass | 473.85 |
| IUPAC Name | 4,9-dichloroquinolino[7,8-h]quinoline;palladium(2+);dichloride |
| SMILES | Clc1ccnc2c1ccc1ccc3c(Cl)ccnc3c12.[Cl-].[Cl-].[Pd+2] |
| InChI | InChI=1S/C16H8Cl2N2.2ClH.Pd/c17-12-5-7-19-15-10(12)3-1-9-2-4-11-13(18)6-8-20-16(11)14(9)15;;;/h1-8H;2*1H;/q;;;+2/p-2 |
| InChIKey | LUDHYAYKJHSCEW-UHFFFAOYSA-L |
| XLogP | -0.75 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.49 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|