C11H9ClN2O — CID 177053142
4-chloro-8-cyclopropyloxy-1,7-naphthyridine (PubChem CID 177053142) has the molecular formula C11H9ClN2O and a molecular weight of 220.66 g/mol. Its IUPAC name is 4-chloro-8-cyclopropyloxy-1,7-naphthyridine.
| Compound Name | 4-chloro-8-cyclopropyloxy-1,7-naphthyridine |
|---|---|
| PubChem CID | 177053142 |
| Molecular Formula | C11H9ClN2O |
| Molecular Weight | 220.66 g/mol |
| Exact Mass | 220.04 |
| IUPAC Name | 4-chloro-8-cyclopropyloxy-1,7-naphthyridine |
| SMILES | Clc1ccnc2c(OC3CC3)nccc12 |
| InChI | InChI=1S/C11H9ClN2O/c12-9-4-6-13-10-8(9)3-5-14-11(10)15-7-1-2-7/h3-7H,1-2H2 |
| InChIKey | AOTYJJILRUAUDG-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.66 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |