C6H4Cl2FNO — CID 67376362
3,4-dichloro-2-(fluoromethoxy)pyridine (PubChem CID 67376362) has the molecular formula C6H4Cl2FNO and a molecular weight of 196.01 g/mol. Its IUPAC name is 3,4-dichloro-2-(fluoromethoxy)pyridine.
| Compound Name | 3,4-dichloro-2-(fluoromethoxy)pyridine |
|---|---|
| PubChem CID | 67376362 |
| Molecular Formula | C6H4Cl2FNO |
| Molecular Weight | 196.01 g/mol |
| Exact Mass | 194.97 |
| IUPAC Name | 3,4-dichloro-2-(fluoromethoxy)pyridine |
| SMILES | FCOc1nccc(Cl)c1Cl |
| InChI | InChI=1S/C6H4Cl2FNO/c7-4-1-2-10-6(5(4)8)11-3-9/h1-2H,3H2 |
| InChIKey | PNAPPILZSUOEKL-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.01 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |