C6H3Cl2NO2 — CID 164738459
(3,4-dichloro-2-pyridinyl) formate (PubChem CID 164738459) has the molecular formula C6H3Cl2NO2 and a molecular weight of 192.00 g/mol. Its IUPAC name is (3,4-dichloro-2-pyridinyl) formate.
| Compound Name | (3,4-dichloro-2-pyridinyl) formate |
|---|---|
| PubChem CID | 164738459 |
| Molecular Formula | C6H3Cl2NO2 |
| Molecular Weight | 192.00 g/mol |
| Exact Mass | 190.95 |
| IUPAC Name | (3,4-dichloro-2-pyridinyl) formate |
| SMILES | O=COc1nccc(Cl)c1Cl |
| InChI | InChI=1S/C6H3Cl2NO2/c7-4-1-2-9-6(5(4)8)11-3-10/h1-3H |
| InChIKey | NUMDUGMLXKXQFQ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.00 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|