About (2-amino-4-chloro-3-pyridinyl) formate;(4-chloro-2-methyl-3-pyridinyl) formate;methane
(2-amino-4-chloro-3-pyridinyl) formate;(4-chloro-2-methyl-3-pyridinyl) formate;methane (PubChem CID 167665157) has the molecular formula C14H15Cl2N3O4
and a molecular weight of 360.20 g/mol. Its IUPAC name is (2-amino-4-chloro-3-pyridinyl) formate;(4-chloro-2-methyl-3-pyridinyl) formate;methane.
Molecular Properties
| Compound Name | (2-amino-4-chloro-3-pyridinyl) formate;(4-chloro-2-methyl-3-pyridinyl) formate;methane |
| PubChem CID | 167665157 |
| Molecular Formula | C14H15Cl2N3O4 |
| Molecular Weight | 360.20 g/mol |
| Exact Mass | 359.04 |
| IUPAC Name | (2-amino-4-chloro-3-pyridinyl) formate;(4-chloro-2-methyl-3-pyridinyl) formate;methane |
| SMILES | C.Cc1nccc(Cl)c1OC=O.Nc1nccc(Cl)c1OC=O |
| InChI | InChI=1S/C7H6ClNO2.C6H5ClN2O2.CH4/c1-5-7(11-4-10)6(8)2-3-9-5;7-4-1-2-9-6(8)5(4)11-3-10;/h2-4H,1H3;1-3H,(H2,8,9);1H4 |
| InChIKey | SNHFIZJAUHWFEU-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 104.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.20 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (2-amino-4-chloro-3-pyridinyl) formate;(4-chloro-2-methyl-3-pyridinyl) formate;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-amino-4-chloro-3-pyridinyl) formate;(4-chloro-2-methyl-3-pyridinyl) formate;methane?
The IUPAC name of (2-amino-4-chloro-3-pyridinyl) formate;(4-chloro-2-methyl-3-pyridinyl) formate;methane (CID 167665157) is (2-amino-4-chloro-3-pyridinyl) formate;(4-chloro-2-methyl-3-pyridinyl) formate;methane.
What is the SMILES notation for (2-amino-4-chloro-3-pyridinyl) formate;(4-chloro-2-methyl-3-pyridinyl) formate;methane?
The canonical SMILES for (2-amino-4-chloro-3-pyridinyl) formate;(4-chloro-2-methyl-3-pyridinyl) formate;methane is C.Cc1nccc(Cl)c1OC=O.Nc1nccc(Cl)c1OC=O.
What is the InChIKey of (2-amino-4-chloro-3-pyridinyl) formate;(4-chloro-2-methyl-3-pyridinyl) formate;methane?
The InChIKey is SNHFIZJAUHWFEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6ClNO2.C6H5ClN2O2.CH4/c1-5-7(11-4-10)6(8)2-3-9-5;7-4-1-2-9-6(8)5(4)11-3-10;/h2-4H,1H3;1-3H,(H2,8,9);1H4.
What are the key properties of (2-amino-4-chloro-3-pyridinyl) formate;(4-chloro-2-methyl-3-pyridinyl) formate;methane?
(2-amino-4-chloro-3-pyridinyl) formate;(4-chloro-2-methyl-3-pyridinyl) formate;methane has a molecular weight of 360.20 g/mol, XLogP of 3.07, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-4-chloro-3-pyridinyl) formate;(4-chloro-2-methyl-3-pyridinyl) formate;methane is sourced from PubChem (CID 167665157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).