C16H10ClN — CID 70373092
4-chloro-11H-indeno[1,2-h]quinoline (PubChem CID 70373092) has the molecular formula C16H10ClN and a molecular weight of 251.72 g/mol. Its IUPAC name is 4-chloro-11H-indeno[1,2-h]quinoline.
| Compound Name | 4-chloro-11H-indeno[1,2-h]quinoline |
|---|---|
| PubChem CID | 70373092 |
| Molecular Formula | C16H10ClN |
| Molecular Weight | 251.72 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | 4-chloro-11H-indeno[1,2-h]quinoline |
| SMILES | Clc1ccnc2c3c(ccc12)-c1ccccc1C3 |
| InChI | InChI=1S/C16H10ClN/c17-15-7-8-18-16-13(15)6-5-12-11-4-2-1-3-10(11)9-14(12)16/h1-8H,9H2 |
| InChIKey | FBTFBLYJTNDZDV-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.72 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |