C17H10ClNO — CID 123639449
6-chloro-7H-naphtho[3,2-h]quinolin-12-one (PubChem CID 123639449) has the molecular formula C17H10ClNO and a molecular weight of 279.73 g/mol. Its IUPAC name is 6-chloro-7H-naphtho[3,2-h]quinolin-12-one.
| Compound Name | 6-chloro-7H-naphtho[3,2-h]quinolin-12-one |
|---|---|
| PubChem CID | 123639449 |
| Molecular Formula | C17H10ClNO |
| Molecular Weight | 279.73 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | 6-chloro-7H-naphtho[3,2-h]quinolin-12-one |
| SMILES | O=C1c2ccccc2Cc2c(Cl)cc3cccnc3c21 |
| InChI | InChI=1S/C17H10ClNO/c18-14-9-11-5-3-7-19-16(11)15-13(14)8-10-4-1-2-6-12(10)17(15)20/h1-7,9H,8H2 |
| InChIKey | ONQWLXFHPNNNGJ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.73 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |