C10H6Cl2O — CID 123154682
2,3-dichloro-4H-naphthalen-1-one (PubChem CID 123154682) has the molecular formula C10H6Cl2O and a molecular weight of 213.06 g/mol. Its IUPAC name is 2,3-dichloro-4H-naphthalen-1-one.
| Compound Name | 2,3-dichloro-4H-naphthalen-1-one |
|---|---|
| PubChem CID | 123154682 |
| Molecular Formula | C10H6Cl2O |
| Molecular Weight | 213.06 g/mol |
| Exact Mass | 211.98 |
| IUPAC Name | 2,3-dichloro-4H-naphthalen-1-one |
| SMILES | O=C1C(Cl)=C(Cl)Cc2ccccc21 |
| InChI | InChI=1S/C10H6Cl2O/c11-8-5-6-3-1-2-4-7(6)10(13)9(8)12/h1-4H,5H2 |
| InChIKey | RGEHOTMWMYXZBR-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.06 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|