C22H20Cl2O — CID 90700809
2-chloro-3-[4-(4-chlorophenyl)cyclohexyl]-4H-naphthalen-1-one (PubChem CID 90700809) has the molecular formula C22H20Cl2O and a molecular weight of 371.31 g/mol. Its IUPAC name is 2-chloro-3-[4-(4-chlorophenyl)cyclohexyl]-4H-naphthalen-1-one.
| Compound Name | 2-chloro-3-[4-(4-chlorophenyl)cyclohexyl]-4H-naphthalen-1-one |
|---|---|
| PubChem CID | 90700809 |
| Molecular Formula | C22H20Cl2O |
| Molecular Weight | 371.31 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | 2-chloro-3-[4-(4-chlorophenyl)cyclohexyl]-4H-naphthalen-1-one |
| SMILES | O=C1C(Cl)=C(C2CCC(c3ccc(Cl)cc3)CC2)Cc2ccccc21 |
| InChI | InChI=1S/C22H20Cl2O/c23-18-11-9-15(10-12-18)14-5-7-16(8-6-14)20-13-17-3-1-2-4-19(17)22(25)21(20)24/h1-4,9-12,14,16H,5-8,13H2 |
| InChIKey | PUOBAOPVBSFQRG-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.31 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|