C32H35ClO6 — CID 164563518
10-[3-[4-(4-chlorophenyl)cyclohexyl]-1,4-dioxonaphthalen-2-yl]oxy-10-oxodecanoic acid (PubChem CID 164563518) has the molecular formula C32H35ClO6 and a molecular weight of 551.08 g/mol. Its IUPAC name is 10-[3-[4-(4-chlorophenyl)cyclohexyl]-1,4-dioxonaphthalen-2-yl]oxy-10-oxodecanoic acid.
| Compound Name | 10-[3-[4-(4-chlorophenyl)cyclohexyl]-1,4-dioxonaphthalen-2-yl]oxy-10-oxodecanoic acid |
|---|---|
| PubChem CID | 164563518 |
| Molecular Formula | C32H35ClO6 |
| Molecular Weight | 551.08 g/mol |
| Exact Mass | 550.21 |
| IUPAC Name | 10-[3-[4-(4-chlorophenyl)cyclohexyl]-1,4-dioxonaphthalen-2-yl]oxy-10-oxodecanoic acid |
| SMILES | O=C(O)CCCCCCCCC(=O)OC1=C(C2CCC(c3ccc(Cl)cc3)CC2)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C32H35ClO6/c33-24-19-17-22(18-20-24)21-13-15-23(16-14-21)29-30(37)25-9-7-8-10-26(25)31(38)32(29)39-28(36)12-6-4-2-1-3-5-11-27(34)35/h7-10,17-21,23H,1-6,11-16H2,(H,34,35) |
| InChIKey | VMROTVDTMBWHFL-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.08 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|