C29H22ClFO4 — CID 44514579
[3-[4-(4-chlorophenyl)cyclohexyl]-1,4-dioxonaphthalen-2-yl] 4-fluorobenzoate (PubChem CID 44514579) has the molecular formula C29H22ClFO4 and a molecular weight of 488.94 g/mol. Its IUPAC name is [3-[4-(4-chlorophenyl)cyclohexyl]-1,4-dioxonaphthalen-2-yl] 4-fluorobenzoate.
| Compound Name | [3-[4-(4-chlorophenyl)cyclohexyl]-1,4-dioxonaphthalen-2-yl] 4-fluorobenzoate |
|---|---|
| PubChem CID | 44514579 |
| Molecular Formula | C29H22ClFO4 |
| Molecular Weight | 488.94 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | [3-[4-(4-chlorophenyl)cyclohexyl]-1,4-dioxonaphthalen-2-yl] 4-fluorobenzoate |
| SMILES | O=C(OC1=C(C2CCC(c3ccc(Cl)cc3)CC2)C(=O)c2ccccc2C1=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C29H22ClFO4/c30-21-13-9-18(10-14-21)17-5-7-19(8-6-17)25-26(32)23-3-1-2-4-24(23)27(33)28(25)35-29(34)20-11-15-22(31)16-12-20/h1-4,9-17,19H,5-8H2 |
| InChIKey | HNJGFVRMNKDWGA-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.94 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|