C25H14ClFO4 — CID 122370127
(2S,3S)-3-(4-chlorophenyl)-2-(4-fluorobenzoyl)-2,3-dihydrobenzo[f][1]benzofuran-4,9-dione (PubChem CID 122370127) has the molecular formula C25H14ClFO4 and a molecular weight of 432.83 g/mol. Its IUPAC name is (2S,3S)-3-(4-chlorophenyl)-2-(4-fluorobenzoyl)-2,3-dihydrobenzo[f][1]benzofuran-4,9-dione.
| Compound Name | (2S,3S)-3-(4-chlorophenyl)-2-(4-fluorobenzoyl)-2,3-dihydrobenzo[f][1]benzofuran-4,9-dione |
|---|---|
| PubChem CID | 122370127 |
| Molecular Formula | C25H14ClFO4 |
| Molecular Weight | 432.83 g/mol |
| Exact Mass | 432.06 |
| IUPAC Name | (2S,3S)-3-(4-chlorophenyl)-2-(4-fluorobenzoyl)-2,3-dihydrobenzo[f][1]benzofuran-4,9-dione |
| SMILES | O=C1C2=C(C(=O)c3ccccc31)[C@H](c1ccc(Cl)cc1)[C@@H](C(=O)c1ccc(F)cc1)O2 |
| InChI | InChI=1S/C25H14ClFO4/c26-15-9-5-13(6-10-15)19-20-22(29)17-3-1-2-4-18(17)23(30)25(20)31-24(19)21(28)14-7-11-16(27)12-8-14/h1-12,19,24H/t19-,24-/m0/s1 |
| InChIKey | QXRBHDUCWLEDGJ-CYFREDJKSA-N |
| XLogP | 5.18 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.83 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|