C16H9FO3 — CID 122369754
2-(4-fluorobenzoyl)indene-1,3-dione (PubChem CID 122369754) has the molecular formula C16H9FO3 and a molecular weight of 268.24 g/mol. Its IUPAC name is 2-(4-fluorobenzoyl)indene-1,3-dione.
| Compound Name | 2-(4-fluorobenzoyl)indene-1,3-dione |
|---|---|
| PubChem CID | 122369754 |
| Molecular Formula | C16H9FO3 |
| Molecular Weight | 268.24 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 2-(4-fluorobenzoyl)indene-1,3-dione |
| SMILES | O=C(c1ccc(F)cc1)C1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C16H9FO3/c17-10-7-5-9(6-8-10)14(18)13-15(19)11-3-1-2-4-12(11)16(13)20/h1-8,13H |
| InChIKey | GNNOPWVZOFUGEQ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.24 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|