C16H9ClO3 — CID 22648334
2-(3-chlorobenzoyl)indene-1,3-dione (PubChem CID 22648334) has the molecular formula C16H9ClO3 and a molecular weight of 284.70 g/mol. Its IUPAC name is 2-(3-chlorobenzoyl)indene-1,3-dione.
| Compound Name | 2-(3-chlorobenzoyl)indene-1,3-dione |
|---|---|
| PubChem CID | 22648334 |
| Molecular Formula | C16H9ClO3 |
| Molecular Weight | 284.70 g/mol |
| Exact Mass | 284.02 |
| IUPAC Name | 2-(3-chlorobenzoyl)indene-1,3-dione |
| SMILES | O=C(c1cccc(Cl)c1)C1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C16H9ClO3/c17-10-5-3-4-9(8-10)14(18)13-15(19)11-6-1-2-7-12(11)16(13)20/h1-8,13H |
| InChIKey | IUBMPRVDSFYURK-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.70 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|