About benzoic acid;3-chlorobenzoic acid
benzoic acid;3-chlorobenzoic acid (PubChem CID 162034638) has the molecular formula C14H11ClO4
and a molecular weight of 278.69 g/mol. Its IUPAC name is benzoic acid;3-chlorobenzoic acid.
Molecular Properties
| Compound Name | benzoic acid;3-chlorobenzoic acid |
| PubChem CID | 162034638 |
| Molecular Formula | C14H11ClO4 |
| Molecular Weight | 278.69 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | benzoic acid;3-chlorobenzoic acid |
| SMILES | O=C(O)c1cccc(Cl)c1.O=C(O)c1ccccc1 |
| InChI | InChI=1S/C7H5ClO2.C7H6O2/c8-6-3-1-2-5(4-6)7(9)10;8-7(9)6-4-2-1-3-5-6/h1-4H,(H,9,10);1-5H,(H,8,9) |
| InChIKey | YWMGYLIAENQFPK-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.69 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzoic acid;3-chlorobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzoic acid;3-chlorobenzoic acid?
The IUPAC name of benzoic acid;3-chlorobenzoic acid (CID 162034638) is benzoic acid;3-chlorobenzoic acid.
What is the SMILES notation for benzoic acid;3-chlorobenzoic acid?
The canonical SMILES for benzoic acid;3-chlorobenzoic acid is O=C(O)c1cccc(Cl)c1.O=C(O)c1ccccc1.
What is the InChIKey of benzoic acid;3-chlorobenzoic acid?
The InChIKey is YWMGYLIAENQFPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5ClO2.C7H6O2/c8-6-3-1-2-5(4-6)7(9)10;8-7(9)6-4-2-1-3-5-6/h1-4H,(H,9,10);1-5H,(H,8,9).
What are the key properties of benzoic acid;3-chlorobenzoic acid?
benzoic acid;3-chlorobenzoic acid has a molecular weight of 278.69 g/mol, XLogP of 3.42, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzoic acid;3-chlorobenzoic acid is sourced from PubChem (CID 162034638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).