C16H9Cl2NO3 — CID 91678852
3-chloro-N-(2-chloro-1,3-dioxoinden-2-yl)benzamide (PubChem CID 91678852) has the molecular formula C16H9Cl2NO3 and a molecular weight of 334.16 g/mol. Its IUPAC name is 3-chloro-N-(2-chloro-1,3-dioxoinden-2-yl)benzamide.
| Compound Name | 3-chloro-N-(2-chloro-1,3-dioxoinden-2-yl)benzamide |
|---|---|
| PubChem CID | 91678852 |
| Molecular Formula | C16H9Cl2NO3 |
| Molecular Weight | 334.16 g/mol |
| Exact Mass | 333.00 |
| IUPAC Name | 3-chloro-N-(2-chloro-1,3-dioxoinden-2-yl)benzamide |
| SMILES | O=C(NC1(Cl)C(=O)c2ccccc2C1=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H9Cl2NO3/c17-10-5-3-4-9(8-10)15(22)19-16(18)13(20)11-6-1-2-7-12(11)14(16)21/h1-8H,(H,19,22) |
| InChIKey | LJUIBFWPHSTLJR-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.16 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|