C21H17ClN2O2 — CID 1378804
3-chloro-N'-(2,2-diphenylacetyl)benzohydrazide (PubChem CID 1378804) has the molecular formula C21H17ClN2O2 and a molecular weight of 364.83 g/mol. Its IUPAC name is 3-chloro-N'-(2,2-diphenylacetyl)benzohydrazide.
| Compound Name | 3-chloro-N'-(2,2-diphenylacetyl)benzohydrazide |
|---|---|
| PubChem CID | 1378804 |
| Molecular Formula | C21H17ClN2O2 |
| Molecular Weight | 364.83 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | 3-chloro-N'-(2,2-diphenylacetyl)benzohydrazide |
| SMILES | O=C(NNC(=O)C(c1ccccc1)c1ccccc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C21H17ClN2O2/c22-18-13-7-12-17(14-18)20(25)23-24-21(26)19(15-8-3-1-4-9-15)16-10-5-2-6-11-16/h1-14,19H,(H,23,25)(H,24,26) |
| InChIKey | KOTCOPMZIOXJCI-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.83 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|