C17H15ClN6O2 — CID 95781242
3-chloro-N'-[(2S)-2-(5-phenyltetrazol-2-yl)propanoyl]benzohydrazide (PubChem CID 95781242) has the molecular formula C17H15ClN6O2 and a molecular weight of 370.80 g/mol. Its IUPAC name is 3-chloro-N'-[(2S)-2-(5-phenyltetrazol-2-yl)propanoyl]benzohydrazide.
| Compound Name | 3-chloro-N'-[(2S)-2-(5-phenyltetrazol-2-yl)propanoyl]benzohydrazide |
|---|---|
| PubChem CID | 95781242 |
| Molecular Formula | C17H15ClN6O2 |
| Molecular Weight | 370.80 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | 3-chloro-N'-[(2S)-2-(5-phenyltetrazol-2-yl)propanoyl]benzohydrazide |
| SMILES | C[C@@H](C(=O)NNC(=O)c1cccc(Cl)c1)n1nnc(-c2ccccc2)n1 |
| InChI | InChI=1S/C17H15ClN6O2/c1-11(24-22-15(19-23-24)12-6-3-2-4-7-12)16(25)20-21-17(26)13-8-5-9-14(18)10-13/h2-11H,1H3,(H,20,25)(H,21,26)/t11-/m0/s1 |
| InChIKey | AJWHETHSJMKQMU-NSHDSACASA-N |
| XLogP | 2.02 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.80 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|