C13H19ClN6O — CID 119504464
N-[2-(methylamino)ethyl]-2-(5-phenyltetrazol-2-yl)propanamide;hydrochloride (PubChem CID 119504464) has the molecular formula C13H19ClN6O and a molecular weight of 310.79 g/mol. Its IUPAC name is N-[2-(methylamino)ethyl]-2-(5-phenyltetrazol-2-yl)propanamide;hydrochloride.
| Compound Name | N-[2-(methylamino)ethyl]-2-(5-phenyltetrazol-2-yl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 119504464 |
| Molecular Formula | C13H19ClN6O |
| Molecular Weight | 310.79 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | N-[2-(methylamino)ethyl]-2-(5-phenyltetrazol-2-yl)propanamide;hydrochloride |
| SMILES | CNCCNC(=O)C(C)n1nnc(-c2ccccc2)n1.Cl |
| InChI | InChI=1S/C13H18N6O.ClH/c1-10(13(20)15-9-8-14-2)19-17-12(16-18-19)11-6-4-3-5-7-11;/h3-7,10,14H,8-9H2,1-2H3,(H,15,20);1H |
| InChIKey | NMRNUAJXWDTGQE-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.79 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|