C16H24N6O — CID 119505106
N-[2-(ethylamino)ethyl]-3-methyl-2-(5-phenyltetrazol-2-yl)butanamide (PubChem CID 119505106) has the molecular formula C16H24N6O and a molecular weight of 316.41 g/mol. Its IUPAC name is N-[2-(ethylamino)ethyl]-3-methyl-2-(5-phenyltetrazol-2-yl)butanamide.
| Compound Name | N-[2-(ethylamino)ethyl]-3-methyl-2-(5-phenyltetrazol-2-yl)butanamide |
|---|---|
| PubChem CID | 119505106 |
| Molecular Formula | C16H24N6O |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | N-[2-(ethylamino)ethyl]-3-methyl-2-(5-phenyltetrazol-2-yl)butanamide |
| SMILES | CCNCCNC(=O)C(C(C)C)n1nnc(-c2ccccc2)n1 |
| InChI | InChI=1S/C16H24N6O/c1-4-17-10-11-18-16(23)14(12(2)3)22-20-15(19-21-22)13-8-6-5-7-9-13/h5-9,12,14,17H,4,10-11H2,1-3H3,(H,18,23) |
| InChIKey | PZQVSLFCQLQUTH-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|