C15H19N5O3 — CID 119346239
2-[methyl-[3-methyl-2-(5-phenyltetrazol-2-yl)butanoyl]amino]acetic acid (PubChem CID 119346239) has the molecular formula C15H19N5O3 and a molecular weight of 317.35 g/mol. Its IUPAC name is 2-[methyl-[3-methyl-2-(5-phenyltetrazol-2-yl)butanoyl]amino]acetic acid.
| Compound Name | 2-[methyl-[3-methyl-2-(5-phenyltetrazol-2-yl)butanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 119346239 |
| Molecular Formula | C15H19N5O3 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | 2-[methyl-[3-methyl-2-(5-phenyltetrazol-2-yl)butanoyl]amino]acetic acid |
| SMILES | CC(C)C(C(=O)N(C)CC(=O)O)n1nnc(-c2ccccc2)n1 |
| InChI | InChI=1S/C15H19N5O3/c1-10(2)13(15(23)19(3)9-12(21)22)20-17-14(16-18-20)11-7-5-4-6-8-11/h4-8,10,13H,9H2,1-3H3,(H,21,22) |
| InChIKey | BRQREKBVOMSURN-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |