C18H17ClN6O2 — CID 51246951
N'-[2-[5-(4-chlorophenyl)tetrazol-2-yl]butanoyl]benzohydrazide (PubChem CID 51246951) has the molecular formula C18H17ClN6O2 and a molecular weight of 384.83 g/mol. Its IUPAC name is N'-[2-[5-(4-chlorophenyl)tetrazol-2-yl]butanoyl]benzohydrazide.
| Compound Name | N'-[2-[5-(4-chlorophenyl)tetrazol-2-yl]butanoyl]benzohydrazide |
|---|---|
| PubChem CID | 51246951 |
| Molecular Formula | C18H17ClN6O2 |
| Molecular Weight | 384.83 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | N'-[2-[5-(4-chlorophenyl)tetrazol-2-yl]butanoyl]benzohydrazide |
| SMILES | CCC(C(=O)NNC(=O)c1ccccc1)n1nnc(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C18H17ClN6O2/c1-2-15(18(27)22-21-17(26)13-6-4-3-5-7-13)25-23-16(20-24-25)12-8-10-14(19)11-9-12/h3-11,15H,2H2,1H3,(H,21,26)(H,22,27) |
| InChIKey | RIOVNYIYZSVNAW-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.83 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|