C18H19ClN6O3S — CID 24676066
2-[5-(4-chlorophenyl)tetrazol-2-yl]-N-[4-(sulfamoylmethyl)phenyl]butanamide (PubChem CID 24676066) has the molecular formula C18H19ClN6O3S and a molecular weight of 434.91 g/mol. Its IUPAC name is 2-[5-(4-chlorophenyl)tetrazol-2-yl]-N-[4-(sulfamoylmethyl)phenyl]butanamide.
| Compound Name | 2-[5-(4-chlorophenyl)tetrazol-2-yl]-N-[4-(sulfamoylmethyl)phenyl]butanamide |
|---|---|
| PubChem CID | 24676066 |
| Molecular Formula | C18H19ClN6O3S |
| Molecular Weight | 434.91 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | 2-[5-(4-chlorophenyl)tetrazol-2-yl]-N-[4-(sulfamoylmethyl)phenyl]butanamide |
| SMILES | CCC(C(=O)Nc1ccc(CS(N)(=O)=O)cc1)n1nnc(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C18H19ClN6O3S/c1-2-16(25-23-17(22-24-25)13-5-7-14(19)8-6-13)18(26)21-15-9-3-12(4-10-15)11-29(20,27)28/h3-10,16H,2,11H2,1H3,(H,21,26)(H2,20,27,28) |
| InChIKey | ZPBDQILQJFAEHO-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 132.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.91 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |