C19H18ClN5O3 — CID 26971559
(4-carbamoylphenyl)methyl (2R)-2-[5-(4-chlorophenyl)tetrazol-2-yl]butanoate (PubChem CID 26971559) has the molecular formula C19H18ClN5O3 and a molecular weight of 399.84 g/mol. Its IUPAC name is (4-carbamoylphenyl)methyl (2R)-2-[5-(4-chlorophenyl)tetrazol-2-yl]butanoate.
| Compound Name | (4-carbamoylphenyl)methyl (2R)-2-[5-(4-chlorophenyl)tetrazol-2-yl]butanoate |
|---|---|
| PubChem CID | 26971559 |
| Molecular Formula | C19H18ClN5O3 |
| Molecular Weight | 399.84 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | (4-carbamoylphenyl)methyl (2R)-2-[5-(4-chlorophenyl)tetrazol-2-yl]butanoate |
| SMILES | CC[C@H](C(=O)OCc1ccc(C(N)=O)cc1)n1nnc(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C19H18ClN5O3/c1-2-16(19(27)28-11-12-3-5-13(6-4-12)17(21)26)25-23-18(22-24-25)14-7-9-15(20)10-8-14/h3-10,16H,2,11H2,1H3,(H2,21,26)/t16-/m1/s1 |
| InChIKey | IWSKCXPTWDEJMS-MRXNPFEDSA-N |
| XLogP | 2.79 |
| TPSA | 112.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.84 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |