C17H15ClFN5O — CID 55434010
2-[5-(4-chlorophenyl)tetrazol-2-yl]-N-(4-fluorophenyl)butanamide (PubChem CID 55434010) has the molecular formula C17H15ClFN5O and a molecular weight of 359.79 g/mol. Its IUPAC name is 2-[5-(4-chlorophenyl)tetrazol-2-yl]-N-(4-fluorophenyl)butanamide.
| Compound Name | 2-[5-(4-chlorophenyl)tetrazol-2-yl]-N-(4-fluorophenyl)butanamide |
|---|---|
| PubChem CID | 55434010 |
| Molecular Formula | C17H15ClFN5O |
| Molecular Weight | 359.79 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | 2-[5-(4-chlorophenyl)tetrazol-2-yl]-N-(4-fluorophenyl)butanamide |
| SMILES | CCC(C(=O)Nc1ccc(F)cc1)n1nnc(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C17H15ClFN5O/c1-2-15(17(25)20-14-9-7-13(19)8-10-14)24-22-16(21-23-24)11-3-5-12(18)6-4-11/h3-10,15H,2H2,1H3,(H,20,25) |
| InChIKey | AACMNJGFWRYWTO-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.79 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |