C19H20ClN5O — CID 55433773
2-[5-(4-chlorophenyl)tetrazol-2-yl]-N-(2,5-dimethylphenyl)butanamide (PubChem CID 55433773) has the molecular formula C19H20ClN5O and a molecular weight of 369.86 g/mol. Its IUPAC name is 2-[5-(4-chlorophenyl)tetrazol-2-yl]-N-(2,5-dimethylphenyl)butanamide.
| Compound Name | 2-[5-(4-chlorophenyl)tetrazol-2-yl]-N-(2,5-dimethylphenyl)butanamide |
|---|---|
| PubChem CID | 55433773 |
| Molecular Formula | C19H20ClN5O |
| Molecular Weight | 369.86 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | 2-[5-(4-chlorophenyl)tetrazol-2-yl]-N-(2,5-dimethylphenyl)butanamide |
| SMILES | CCC(C(=O)Nc1cc(C)ccc1C)n1nnc(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C19H20ClN5O/c1-4-17(19(26)21-16-11-12(2)5-6-13(16)3)25-23-18(22-24-25)14-7-9-15(20)10-8-14/h5-11,17H,4H2,1-3H3,(H,21,26) |
| InChIKey | ORADOPREOPADIB-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.86 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |