C20H19ClN6OS — CID 97309347
(2S)-2-[5-(4-chlorophenyl)tetrazol-2-yl]-N-[2-(2-cyanoethylsulfanyl)phenyl]butanamide (PubChem CID 97309347) has the molecular formula C20H19ClN6OS and a molecular weight of 426.93 g/mol. Its IUPAC name is (2S)-2-[5-(4-chlorophenyl)tetrazol-2-yl]-N-[2-(2-cyanoethylsulfanyl)phenyl]butanamide.
| Compound Name | (2S)-2-[5-(4-chlorophenyl)tetrazol-2-yl]-N-[2-(2-cyanoethylsulfanyl)phenyl]butanamide |
|---|---|
| PubChem CID | 97309347 |
| Molecular Formula | C20H19ClN6OS |
| Molecular Weight | 426.93 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | (2S)-2-[5-(4-chlorophenyl)tetrazol-2-yl]-N-[2-(2-cyanoethylsulfanyl)phenyl]butanamide |
| SMILES | CC[C@@H](C(=O)Nc1ccccc1SCCC#N)n1nnc(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C20H19ClN6OS/c1-2-17(27-25-19(24-26-27)14-8-10-15(21)11-9-14)20(28)23-16-6-3-4-7-18(16)29-13-5-12-22/h3-4,6-11,17H,2,5,13H2,1H3,(H,23,28)/t17-/m0/s1 |
| InChIKey | OPSXDOJKSIBRNM-KRWDZBQOSA-N |
| XLogP | 4.59 |
| TPSA | 96.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.93 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|