C17H16ClN5OS — CID 42986987
2-[5-(4-chlorophenyl)tetrazol-2-yl]-N-(2-methylsulfanylphenyl)propanamide (PubChem CID 42986987) has the molecular formula C17H16ClN5OS and a molecular weight of 373.87 g/mol. Its IUPAC name is 2-[5-(4-chlorophenyl)tetrazol-2-yl]-N-(2-methylsulfanylphenyl)propanamide.
| Compound Name | 2-[5-(4-chlorophenyl)tetrazol-2-yl]-N-(2-methylsulfanylphenyl)propanamide |
|---|---|
| PubChem CID | 42986987 |
| Molecular Formula | C17H16ClN5OS |
| Molecular Weight | 373.87 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | 2-[5-(4-chlorophenyl)tetrazol-2-yl]-N-(2-methylsulfanylphenyl)propanamide |
| SMILES | CSc1ccccc1NC(=O)C(C)n1nnc(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C17H16ClN5OS/c1-11(17(24)19-14-5-3-4-6-15(14)25-2)23-21-16(20-22-23)12-7-9-13(18)10-8-12/h3-11H,1-2H3,(H,19,24) |
| InChIKey | SDOWPJROXCSODM-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.87 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |