C17H13F4N5O — CID 9353497
(2R)-N-(2-fluorophenyl)-2-[5-[3-(trifluoromethyl)phenyl]tetrazol-2-yl]propanamide (PubChem CID 9353497) has the molecular formula C17H13F4N5O and a molecular weight of 379.32 g/mol. Its IUPAC name is (2R)-N-(2-fluorophenyl)-2-[5-[3-(trifluoromethyl)phenyl]tetrazol-2-yl]propanamide.
| Compound Name | (2R)-N-(2-fluorophenyl)-2-[5-[3-(trifluoromethyl)phenyl]tetrazol-2-yl]propanamide |
|---|---|
| PubChem CID | 9353497 |
| Molecular Formula | C17H13F4N5O |
| Molecular Weight | 379.32 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | (2R)-N-(2-fluorophenyl)-2-[5-[3-(trifluoromethyl)phenyl]tetrazol-2-yl]propanamide |
| SMILES | C[C@H](C(=O)Nc1ccccc1F)n1nnc(-c2cccc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C17H13F4N5O/c1-10(16(27)22-14-8-3-2-7-13(14)18)26-24-15(23-25-26)11-5-4-6-12(9-11)17(19,20)21/h2-10H,1H3,(H,22,27)/t10-/m1/s1 |
| InChIKey | UFBOIHDSLLGGJB-SNVBAGLBSA-N |
| XLogP | 3.70 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.32 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |