C18H16F3N5OS — CID 25477677
N-(2-methylsulfanylphenyl)-3-[5-[3-(trifluoromethyl)phenyl]tetrazol-2-yl]propanamide (PubChem CID 25477677) has the molecular formula C18H16F3N5OS and a molecular weight of 407.42 g/mol. Its IUPAC name is N-(2-methylsulfanylphenyl)-3-[5-[3-(trifluoromethyl)phenyl]tetrazol-2-yl]propanamide.
| Compound Name | N-(2-methylsulfanylphenyl)-3-[5-[3-(trifluoromethyl)phenyl]tetrazol-2-yl]propanamide |
|---|---|
| PubChem CID | 25477677 |
| Molecular Formula | C18H16F3N5OS |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | N-(2-methylsulfanylphenyl)-3-[5-[3-(trifluoromethyl)phenyl]tetrazol-2-yl]propanamide |
| SMILES | CSc1ccccc1NC(=O)CCn1nnc(-c2cccc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C18H16F3N5OS/c1-28-15-8-3-2-7-14(15)22-16(27)9-10-26-24-17(23-25-26)12-5-4-6-13(11-12)18(19,20)21/h2-8,11H,9-10H2,1H3,(H,22,27) |
| InChIKey | HXYLWBLFIRFASS-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |