C17H18F6N6O — CID 2730782
2-[5-[3,5-bis(trifluoromethyl)phenyl]tetrazol-2-yl]-N-(2,2-dimethylpropylideneamino)propanamide (PubChem CID 2730782) has the molecular formula C17H18F6N6O and a molecular weight of 436.36 g/mol. Its IUPAC name is 2-[5-[3,5-bis(trifluoromethyl)phenyl]tetrazol-2-yl]-N-(2,2-dimethylpropylideneamino)propanamide.
| Compound Name | 2-[5-[3,5-bis(trifluoromethyl)phenyl]tetrazol-2-yl]-N-(2,2-dimethylpropylideneamino)propanamide |
|---|---|
| PubChem CID | 2730782 |
| Molecular Formula | C17H18F6N6O |
| Molecular Weight | 436.36 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | 2-[5-[3,5-bis(trifluoromethyl)phenyl]tetrazol-2-yl]-N-(2,2-dimethylpropylideneamino)propanamide |
| SMILES | CC(C(=O)NN=CC(C)(C)C)n1nnc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C17H18F6N6O/c1-9(14(30)26-24-8-15(2,3)4)29-27-13(25-28-29)10-5-11(16(18,19)20)7-12(6-10)17(21,22)23/h5-9H,1-4H3,(H,26,30) |
| InChIKey | HHJBHTVJXZXXGA-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 85.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.36 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|