C15H20FN5O2 — CID 38958525
(2S)-N-(3-ethoxypropyl)-2-[5-(3-fluorophenyl)tetrazol-2-yl]propanamide (PubChem CID 38958525) has the molecular formula C15H20FN5O2 and a molecular weight of 321.36 g/mol. Its IUPAC name is (2S)-N-(3-ethoxypropyl)-2-[5-(3-fluorophenyl)tetrazol-2-yl]propanamide.
| Compound Name | (2S)-N-(3-ethoxypropyl)-2-[5-(3-fluorophenyl)tetrazol-2-yl]propanamide |
|---|---|
| PubChem CID | 38958525 |
| Molecular Formula | C15H20FN5O2 |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | (2S)-N-(3-ethoxypropyl)-2-[5-(3-fluorophenyl)tetrazol-2-yl]propanamide |
| SMILES | CCOCCCNC(=O)[C@H](C)n1nnc(-c2cccc(F)c2)n1 |
| InChI | InChI=1S/C15H20FN5O2/c1-3-23-9-5-8-17-15(22)11(2)21-19-14(18-20-21)12-6-4-7-13(16)10-12/h4,6-7,10-11H,3,5,8-9H2,1-2H3,(H,17,22)/t11-/m0/s1 |
| InChIKey | RUYNGMKJFGCBHG-NSHDSACASA-N |
| XLogP | 1.58 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|