C17H21F3N6O — CID 95270096
(2S)-1-(4-ethylpiperazin-1-yl)-2-[5-[3-(trifluoromethyl)phenyl]tetrazol-2-yl]propan-1-one (PubChem CID 95270096) has the molecular formula C17H21F3N6O and a molecular weight of 382.39 g/mol. Its IUPAC name is (2S)-1-(4-ethylpiperazin-1-yl)-2-[5-[3-(trifluoromethyl)phenyl]tetrazol-2-yl]propan-1-one.
| Compound Name | (2S)-1-(4-ethylpiperazin-1-yl)-2-[5-[3-(trifluoromethyl)phenyl]tetrazol-2-yl]propan-1-one |
|---|---|
| PubChem CID | 95270096 |
| Molecular Formula | C17H21F3N6O |
| Molecular Weight | 382.39 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | (2S)-1-(4-ethylpiperazin-1-yl)-2-[5-[3-(trifluoromethyl)phenyl]tetrazol-2-yl]propan-1-one |
| SMILES | CCN1CCN(C(=O)[C@H](C)n2nnc(-c3cccc(C(F)(F)F)c3)n2)CC1 |
| InChI | InChI=1S/C17H21F3N6O/c1-3-24-7-9-25(10-8-24)16(27)12(2)26-22-15(21-23-26)13-5-4-6-14(11-13)17(18,19)20/h4-6,11-12H,3,7-10H2,1-2H3/t12-/m0/s1 |
| InChIKey | ORJXMWNHKRYQCY-LBPRGKRZSA-N |
| XLogP | 2.08 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.39 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |