C18H24F3N3O2 — CID 3886112
propan-2-yl 4-ethyl-N-[3-(trifluoromethyl)benzoyl]piperazine-1-carboximidate (PubChem CID 3886112) has the molecular formula C18H24F3N3O2 and a molecular weight of 371.40 g/mol. Its IUPAC name is propan-2-yl 4-ethyl-N-[3-(trifluoromethyl)benzoyl]piperazine-1-carboximidate.
| Compound Name | propan-2-yl 4-ethyl-N-[3-(trifluoromethyl)benzoyl]piperazine-1-carboximidate |
|---|---|
| PubChem CID | 3886112 |
| Molecular Formula | C18H24F3N3O2 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | propan-2-yl 4-ethyl-N-[3-(trifluoromethyl)benzoyl]piperazine-1-carboximidate |
| SMILES | CCN1CCN(/C(=N/C(=O)c2cccc(C(F)(F)F)c2)OC(C)C)CC1 |
| InChI | InChI=1S/C18H24F3N3O2/c1-4-23-8-10-24(11-9-23)17(26-13(2)3)22-16(25)14-6-5-7-15(12-14)18(19,20)21/h5-7,12-13H,4,8-11H2,1-3H3/b22-17- |
| InChIKey | AGAOYGSQCCERRZ-XLNRJJMWSA-N |
| XLogP | 3.26 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|