C21H25N5O — CID 31458753
(2R)-N-[2-[(2R)-butan-2-yl]phenyl]-2-[5-(4-methylphenyl)tetrazol-2-yl]propanamide (PubChem CID 31458753) has the molecular formula C21H25N5O and a molecular weight of 363.47 g/mol. Its IUPAC name is (2R)-N-[2-[(2R)-butan-2-yl]phenyl]-2-[5-(4-methylphenyl)tetrazol-2-yl]propanamide.
| Compound Name | (2R)-N-[2-[(2R)-butan-2-yl]phenyl]-2-[5-(4-methylphenyl)tetrazol-2-yl]propanamide |
|---|---|
| PubChem CID | 31458753 |
| Molecular Formula | C21H25N5O |
| Molecular Weight | 363.47 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | (2R)-N-[2-[(2R)-butan-2-yl]phenyl]-2-[5-(4-methylphenyl)tetrazol-2-yl]propanamide |
| SMILES | CC[C@@H](C)c1ccccc1NC(=O)[C@@H](C)n1nnc(-c2ccc(C)cc2)n1 |
| InChI | InChI=1S/C21H25N5O/c1-5-15(3)18-8-6-7-9-19(18)22-21(27)16(4)26-24-20(23-25-26)17-12-10-14(2)11-13-17/h6-13,15-16H,5H2,1-4H3,(H,22,27)/t15-,16-/m1/s1 |
| InChIKey | PMFVHYAESTVRQU-HZPDHXFCSA-N |
| XLogP | 4.36 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.47 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |