C17H24ClN5O — CID 134022286
2-[5-(4-chlorophenyl)tetrazol-2-yl]-N,N-dipropylbutanamide (PubChem CID 134022286) has the molecular formula C17H24ClN5O and a molecular weight of 349.87 g/mol. Its IUPAC name is 2-[5-(4-chlorophenyl)tetrazol-2-yl]-N,N-dipropylbutanamide.
| Compound Name | 2-[5-(4-chlorophenyl)tetrazol-2-yl]-N,N-dipropylbutanamide |
|---|---|
| PubChem CID | 134022286 |
| Molecular Formula | C17H24ClN5O |
| Molecular Weight | 349.87 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | 2-[5-(4-chlorophenyl)tetrazol-2-yl]-N,N-dipropylbutanamide |
| SMILES | CCCN(CCC)C(=O)C(CC)n1nnc(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C17H24ClN5O/c1-4-11-22(12-5-2)17(24)15(6-3)23-20-16(19-21-23)13-7-9-14(18)10-8-13/h7-10,15H,4-6,11-12H2,1-3H3 |
| InChIKey | LRRYKCHNQRGYGO-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.87 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |