C20H25ClN6O2 — CID 56512012
2-[5-(4-chlorophenyl)tetrazol-2-yl]-1-[4-(cyclobutanecarbonyl)piperazin-1-yl]butan-1-one (PubChem CID 56512012) has the molecular formula C20H25ClN6O2 and a molecular weight of 416.91 g/mol. Its IUPAC name is 2-[5-(4-chlorophenyl)tetrazol-2-yl]-1-[4-(cyclobutanecarbonyl)piperazin-1-yl]butan-1-one.
| Compound Name | 2-[5-(4-chlorophenyl)tetrazol-2-yl]-1-[4-(cyclobutanecarbonyl)piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 56512012 |
| Molecular Formula | C20H25ClN6O2 |
| Molecular Weight | 416.91 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 2-[5-(4-chlorophenyl)tetrazol-2-yl]-1-[4-(cyclobutanecarbonyl)piperazin-1-yl]butan-1-one |
| SMILES | CCC(C(=O)N1CCN(C(=O)C2CCC2)CC1)n1nnc(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C20H25ClN6O2/c1-2-17(27-23-18(22-24-27)14-6-8-16(21)9-7-14)20(29)26-12-10-25(11-13-26)19(28)15-4-3-5-15/h6-9,15,17H,2-5,10-13H2,1H3 |
| InChIKey | SLFUVGKQRRCPIJ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 84.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.91 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |