C21H22ClN7O3 — CID 25382902
(2R)-2-[5-(4-chlorophenyl)tetrazol-2-yl]-1-[4-(2-nitrophenyl)piperazin-1-yl]butan-1-one (PubChem CID 25382902) has the molecular formula C21H22ClN7O3 and a molecular weight of 455.91 g/mol. Its IUPAC name is (2R)-2-[5-(4-chlorophenyl)tetrazol-2-yl]-1-[4-(2-nitrophenyl)piperazin-1-yl]butan-1-one.
| Compound Name | (2R)-2-[5-(4-chlorophenyl)tetrazol-2-yl]-1-[4-(2-nitrophenyl)piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 25382902 |
| Molecular Formula | C21H22ClN7O3 |
| Molecular Weight | 455.91 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | (2R)-2-[5-(4-chlorophenyl)tetrazol-2-yl]-1-[4-(2-nitrophenyl)piperazin-1-yl]butan-1-one |
| SMILES | CC[C@H](C(=O)N1CCN(c2ccccc2[N+](=O)[O-])CC1)n1nnc(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C21H22ClN7O3/c1-2-17(28-24-20(23-25-28)15-7-9-16(22)10-8-15)21(30)27-13-11-26(12-14-27)18-5-3-4-6-19(18)29(31)32/h3-10,17H,2,11-14H2,1H3/t17-/m1/s1 |
| InChIKey | WDPQOGDRYGFZFD-QGZVFWFLSA-N |
| XLogP | 3.20 |
| TPSA | 110.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.91 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|