C19H23ClN4O3 — CID 120666638
2-amino-2-(4-methylphenyl)-1-[4-(2-nitrophenyl)piperazin-1-yl]ethanone;hydrochloride (PubChem CID 120666638) has the molecular formula C19H23ClN4O3 and a molecular weight of 390.87 g/mol. Its IUPAC name is 2-amino-2-(4-methylphenyl)-1-[4-(2-nitrophenyl)piperazin-1-yl]ethanone;hydrochloride.
| Compound Name | 2-amino-2-(4-methylphenyl)-1-[4-(2-nitrophenyl)piperazin-1-yl]ethanone;hydrochloride |
|---|---|
| PubChem CID | 120666638 |
| Molecular Formula | C19H23ClN4O3 |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | 2-amino-2-(4-methylphenyl)-1-[4-(2-nitrophenyl)piperazin-1-yl]ethanone;hydrochloride |
| SMILES | Cc1ccc(C(N)C(=O)N2CCN(c3ccccc3[N+](=O)[O-])CC2)cc1.Cl |
| InChI | InChI=1S/C19H22N4O3.ClH/c1-14-6-8-15(9-7-14)18(20)19(24)22-12-10-21(11-13-22)16-4-2-3-5-17(16)23(25)26;/h2-9,18H,10-13,20H2,1H3;1H |
| InChIKey | QHNPOJZIEJEBHM-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 92.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|