C18H22N6O4 — CID 21254847
1-[4-nitro-3-[4-(2-nitrophenyl)piperazin-1-yl]phenyl]ethane-1,2-diamine (PubChem CID 21254847) has the molecular formula C18H22N6O4 and a molecular weight of 386.41 g/mol. Its IUPAC name is 1-[4-nitro-3-[4-(2-nitrophenyl)piperazin-1-yl]phenyl]ethane-1,2-diamine.
| Compound Name | 1-[4-nitro-3-[4-(2-nitrophenyl)piperazin-1-yl]phenyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 21254847 |
| Molecular Formula | C18H22N6O4 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 1-[4-nitro-3-[4-(2-nitrophenyl)piperazin-1-yl]phenyl]ethane-1,2-diamine |
| SMILES | NCC(N)c1ccc([N+](=O)[O-])c(N2CCN(c3ccccc3[N+](=O)[O-])CC2)c1 |
| InChI | InChI=1S/C18H22N6O4/c19-12-14(20)13-5-6-17(24(27)28)18(11-13)22-9-7-21(8-10-22)15-3-1-2-4-16(15)23(25)26/h1-6,11,14H,7-10,12,19-20H2 |
| InChIKey | JDMLAEHPXZCDPA-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 144.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|