C24H28ClN5O — CID 142781615
1-[4-(4-chlorophenyl)piperidin-1-yl]-3-methyl-2-(5-phenyltetrazol-2-yl)pentan-1-one (PubChem CID 142781615) has the molecular formula C24H28ClN5O and a molecular weight of 437.98 g/mol. Its IUPAC name is 1-[4-(4-chlorophenyl)piperidin-1-yl]-3-methyl-2-(5-phenyltetrazol-2-yl)pentan-1-one.
| Compound Name | 1-[4-(4-chlorophenyl)piperidin-1-yl]-3-methyl-2-(5-phenyltetrazol-2-yl)pentan-1-one |
|---|---|
| PubChem CID | 142781615 |
| Molecular Formula | C24H28ClN5O |
| Molecular Weight | 437.98 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | 1-[4-(4-chlorophenyl)piperidin-1-yl]-3-methyl-2-(5-phenyltetrazol-2-yl)pentan-1-one |
| SMILES | CCC(C)C(C(=O)N1CCC(c2ccc(Cl)cc2)CC1)n1nnc(-c2ccccc2)n1 |
| InChI | InChI=1S/C24H28ClN5O/c1-3-17(2)22(30-27-23(26-28-30)20-7-5-4-6-8-20)24(31)29-15-13-19(14-16-29)18-9-11-21(25)12-10-18/h4-12,17,19,22H,3,13-16H2,1-2H3 |
| InChIKey | SAVVVLOWWAQVGA-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.98 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |