C17H22ClN5O3 — CID 51256542
propan-2-yl 3-[2-[5-(4-chlorophenyl)tetrazol-2-yl]butanoylamino]propanoate (PubChem CID 51256542) has the molecular formula C17H22ClN5O3 and a molecular weight of 379.85 g/mol. Its IUPAC name is propan-2-yl 3-[2-[5-(4-chlorophenyl)tetrazol-2-yl]butanoylamino]propanoate.
| Compound Name | propan-2-yl 3-[2-[5-(4-chlorophenyl)tetrazol-2-yl]butanoylamino]propanoate |
|---|---|
| PubChem CID | 51256542 |
| Molecular Formula | C17H22ClN5O3 |
| Molecular Weight | 379.85 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | propan-2-yl 3-[2-[5-(4-chlorophenyl)tetrazol-2-yl]butanoylamino]propanoate |
| SMILES | CCC(C(=O)NCCC(=O)OC(C)C)n1nnc(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C17H22ClN5O3/c1-4-14(17(25)19-10-9-15(24)26-11(2)3)23-21-16(20-22-23)12-5-7-13(18)8-6-12/h5-8,11,14H,4,9-10H2,1-3H3,(H,19,25) |
| InChIKey | PVLYPLDBSICLTF-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.85 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |