C18H25ClN6O — CID 119558598
2-[5-(4-chlorophenyl)tetrazol-2-yl]-N-(2-piperidin-3-ylethyl)butanamide (PubChem CID 119558598) has the molecular formula C18H25ClN6O and a molecular weight of 376.89 g/mol. Its IUPAC name is 2-[5-(4-chlorophenyl)tetrazol-2-yl]-N-(2-piperidin-3-ylethyl)butanamide.
| Compound Name | 2-[5-(4-chlorophenyl)tetrazol-2-yl]-N-(2-piperidin-3-ylethyl)butanamide |
|---|---|
| PubChem CID | 119558598 |
| Molecular Formula | C18H25ClN6O |
| Molecular Weight | 376.89 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 2-[5-(4-chlorophenyl)tetrazol-2-yl]-N-(2-piperidin-3-ylethyl)butanamide |
| SMILES | CCC(C(=O)NCCC1CCCNC1)n1nnc(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C18H25ClN6O/c1-2-16(18(26)21-11-9-13-4-3-10-20-12-13)25-23-17(22-24-25)14-5-7-15(19)8-6-14/h5-8,13,16,20H,2-4,9-12H2,1H3,(H,21,26) |
| InChIKey | DBKFOSRTSHEAHY-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.89 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |