About 3-chlorobenzohydrazide;bis(formonitrile)
3-chlorobenzohydrazide;bis(formonitrile) (PubChem CID 175536479) has the molecular formula C9H9ClN4O
and a molecular weight of 224.65 g/mol. Its IUPAC name is 3-chlorobenzohydrazide;bis(formonitrile).
Molecular Properties
| Compound Name | 3-chlorobenzohydrazide;bis(formonitrile) |
| PubChem CID | 175536479 |
| Molecular Formula | C9H9ClN4O |
| Molecular Weight | 224.65 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | 3-chlorobenzohydrazide;bis(formonitrile) |
| SMILES | C#N.C#N.NNC(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C7H7ClN2O.2CHN/c8-6-3-1-2-5(4-6)7(11)10-9;2*1-2/h1-4H,9H2,(H,10,11);2*1H |
| InChIKey | CZBDPWHIYWQBEK-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 102.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.65 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-chlorobenzohydrazide;bis(formonitrile) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chlorobenzohydrazide;bis(formonitrile)?
The IUPAC name of 3-chlorobenzohydrazide;bis(formonitrile) (CID 175536479) is 3-chlorobenzohydrazide;bis(formonitrile).
What is the SMILES notation for 3-chlorobenzohydrazide;bis(formonitrile)?
The canonical SMILES for 3-chlorobenzohydrazide;bis(formonitrile) is C#N.C#N.NNC(=O)c1cccc(Cl)c1.
What is the InChIKey of 3-chlorobenzohydrazide;bis(formonitrile)?
The InChIKey is CZBDPWHIYWQBEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7ClN2O.2CHN/c8-6-3-1-2-5(4-6)7(11)10-9;2*1-2/h1-4H,9H2,(H,10,11);2*1H.
What are the key properties of 3-chlorobenzohydrazide;bis(formonitrile)?
3-chlorobenzohydrazide;bis(formonitrile) has a molecular weight of 224.65 g/mol, XLogP of 1.22, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chlorobenzohydrazide;bis(formonitrile) is sourced from PubChem (CID 175536479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).