About azane;3-chlorobenzenecarboperoxoic acid
azane;3-chlorobenzenecarboperoxoic acid (PubChem CID 86637115) has the molecular formula C7H8ClNO3
and a molecular weight of 189.60 g/mol. Its IUPAC name is azane;3-chlorobenzenecarboperoxoic acid.
Molecular Properties
| Compound Name | azane;3-chlorobenzenecarboperoxoic acid |
| PubChem CID | 86637115 |
| Molecular Formula | C7H8ClNO3 |
| Molecular Weight | 189.60 g/mol |
| Exact Mass | 189.02 |
| IUPAC Name | azane;3-chlorobenzenecarboperoxoic acid |
| SMILES | N.O=C(OO)c1cccc(Cl)c1 |
| InChI | InChI=1S/C7H5ClO3.H3N/c8-6-3-1-2-5(4-6)7(9)11-10;/h1-4,10H;1H3 |
| InChIKey | RLVJJHOLZLYPQF-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 81.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.60 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze azane;3-chlorobenzenecarboperoxoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;3-chlorobenzenecarboperoxoic acid?
The IUPAC name of azane;3-chlorobenzenecarboperoxoic acid (CID 86637115) is azane;3-chlorobenzenecarboperoxoic acid.
What is the SMILES notation for azane;3-chlorobenzenecarboperoxoic acid?
The canonical SMILES for azane;3-chlorobenzenecarboperoxoic acid is N.O=C(OO)c1cccc(Cl)c1.
What is the InChIKey of azane;3-chlorobenzenecarboperoxoic acid?
The InChIKey is RLVJJHOLZLYPQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5ClO3.H3N/c8-6-3-1-2-5(4-6)7(9)11-10;/h1-4,10H;1H3.
What are the key properties of azane;3-chlorobenzenecarboperoxoic acid?
azane;3-chlorobenzenecarboperoxoic acid has a molecular weight of 189.60 g/mol, XLogP of 2.13, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;3-chlorobenzenecarboperoxoic acid is sourced from PubChem (CID 86637115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).